| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:46 UTC |
|---|
| Update Date | 2025-03-25 01:02:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253401 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15N5O10P2 |
|---|
| Molecular Mass | 427.0294 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1C(O)C(O)(COP(=O)(O)OP(=O)(O)O)C1O |
|---|
| InChI Key | KRANPQMEEMHLSI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | nucleoside and nucleotide analogues |
|---|
| Subclass | cyclobutyl nucleosides |
|---|
| Direct Parent | cyclobutyl nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscyclic alcohols and derivativesheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonoalkyl phosphatesn-substituted imidazolesorganic oxidesorganic pyrophosphatesorganopnictogen compoundsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholstertiary alcohols |
|---|
| Substituents | imidazopyrimidinepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazolecyclobutanolorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundazolecyclobutyl purine nucleosiden-substituted imidazolealcoholazacycleheteroaromatic compoundcyclobutyl nucleosideorganic pyrophosphatetertiary alcoholorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|