| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:47 UTC |
|---|
| Update Date | 2025-03-25 01:02:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253409 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H11N5O |
|---|
| Molecular Mass | 253.0964 |
|---|
| SMILES | Nc1ncnc2c(Nc3ccc(O)cc3)ccnc12 |
|---|
| InChI Key | VXWUMGWXMKXKSR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridopyrimidines |
|---|
| Subclass | pyridopyrimidines |
|---|
| Direct Parent | pyridopyrimidines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids2-halopyridinesazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesimidolactamsorganooxygen compoundsorganopnictogen compoundspolyhalopyridinesprimary aminespyrimidines and pyrimidine derivativessecondary amines |
|---|
| Substituents | monocyclic benzene moietypolyhalopyridine1-hydroxy-2-unsubstituted benzenoidpyrimidinearomatic heteropolycyclic compoundorganonitrogen compoundpyridopyrimidineorganopnictogen compound2-halopyridineimidolactamazacycleheteroaromatic compoundhydroxypyridinesecondary aminepyridineorganic oxygen compoundphenolhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|