| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 15:22:49 UTC |
|---|
| Update Date | 2025-03-25 01:02:03 UTC |
|---|
| HMDB ID | HMDB0060640 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253497 |
|---|
| Name | Lamivudine-triphosphate |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H14N3O12P3S |
|---|
| Molecular Mass | 468.9511 |
|---|
| SMILES | Nc1ccn(C2CSC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)n1 |
|---|
| InChI Key | YLEQMGZZMCJKCN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | nucleoside and nucleotide analogues |
|---|
| Subclass | nucleoside and nucleotide analogues |
|---|
| Direct Parent | nucleoside and nucleotide analogues |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonoalkyl phosphatesmonothioacetalsorganic carbonic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsoxathiolanesprimary aminespyrimidones |
|---|
| Substituents | oxathiolanearomatic heteromonocyclic compoundpyrimidonepyrimidinemonothioacetalorganic oxideorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundcarbonic acid derivativeazacycleheteroaromatic compoundoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatehydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|