| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:49 UTC |
|---|
| Update Date | 2025-03-25 01:02:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253499 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H18N3O11P |
|---|
| Molecular Mass | 411.0679 |
|---|
| SMILES | Nc1ccn(C2OC(CO)C(O)C2OC(=O)C(O)COP(=O)(O)O)c(=O)n1 |
|---|
| InChI Key | PKFRYFOKANKACF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrimidine nucleosides |
|---|
| Subclass | pyrimidine nucleosides |
|---|
| Direct Parent | pyrimidine nucleosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acid estersheteroaromatic compoundshydrocarbon derivativesimidolactamsmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespyrimidonessecondary alcoholssugar acids and derivativestetrahydrofurans |
|---|
| Substituents | carbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesmonosaccharidepyrimidonecarboxylic acid derivativepyrimidinesaccharideorganic oxideglyceric_acidorganonitrogen compoundorganopnictogen compoundpyrimidine nucleosideprimary alcoholimidolactamorganoheterocyclic compoundalcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatecarboxylic acid estersecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
