| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:49 UTC |
|---|
| Update Date | 2025-03-25 01:02:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253514 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H10N3O5PS |
|---|
| Molecular Mass | 267.0079 |
|---|
| SMILES | Nc1nc(CC(N)C(=O)OP(=O)(O)O)cs1 |
|---|
| InChI Key | QOOKOZYMOVOIBO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2,4-disubstituted thiazolesacyl monophosphatesazacyclic compoundscarbonyl compoundsheteroaromatic compoundshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganopnictogen compoundsphosphoethanolamines |
|---|
| Substituents | carbonyl grouparomatic heteromonocyclic compoundphosphoethanolamineorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundazoleazacycleacyl monophosphateheteroaromatic compoundmonocarboxylic acid or derivativesorganic oxygen compound2,4-disubstituted 1,3-thiazolehydrocarbon derivativeprimary aliphatic amineprimary amineorganic nitrogen compoundthiazoleorganic phosphoric acid derivativeamineorganooxygen compoundacyl phosphate |
|---|
