| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:51 UTC |
|---|
| Update Date | 2025-03-25 01:02:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253576 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H19NO7 |
|---|
| Molecular Mass | 373.1162 |
|---|
| SMILES | O=C(CCC(O)Cc1cc(O)cc(O)c1)OC1Oc2ccccc2NC1=O |
|---|
| InChI Key | ZHGKPWQKTVVHEN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzoxazines |
|---|
| Subclass | benzoxazinones |
|---|
| Direct Parent | benzoxazinones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsazacyclic compoundsbenzene and substituted derivativesbenzomorpholinescarbonyl compoundscarboxylic acid estersfatty acid estershydrocarbon derivativeslactamsmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsresorcinolssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl grouplactam1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativebenzomorpholineresorcinolorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalcoholazacycle1-hydroxy-4-unsubstituted benzenoidcarboxamide groupoxazinaneoxacyclesecondary carboxylic acid amidefatty acid estermorpholinemonocarboxylic acid or derivativesbenzoxazinoneorganic oxygen compoundcarboxylic acid estersecondary alcoholphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
