| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:53 UTC |
|---|
| Update Date | 2025-03-25 01:02:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253634 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H23NO12 |
|---|
| Molecular Mass | 505.122 |
|---|
| SMILES | O=C(CO)Nc1cc2c(c(OC3OC(C(=O)O)C(O)C(O)C3O)c1)C(=O)CC(c1ccc(O)cc1)O2 |
|---|
| InChI Key | ZAHSQOQZZDMMNR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavonoid glycosides |
|---|
| Direct Parent | flavonoid o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids4'-hydroxyflavonoidsacetalsalkyl aryl ethersaryl alkyl ketonesbenzene and substituted derivativesbeta hydroxy acids and derivativescarboxylic acidschromonesflavanonesglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesn-arylamideso-glucuronidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenol etherspyran carboxylic acidssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarboxylic acidaryl alkyl ketone1-benzopyranflavanoneo-glucuronidemonosaccharidepyran carboxylic acidketone1-o-glucuronidebeta-hydroxy acidsaccharideacetalchromoneorganonitrogen compoundoxaneorganoheterocyclic compoundalcoholbenzopyransecondary carboxylic acid amidephenolhydrocarbon derivativearyl ketonecarbonyl groupetherglucuronic acid or derivativesflavan1-hydroxy-2-unsubstituted benzenoidn-arylamidealkyl aryl ethercarboxylic acid derivativeflavonoid-5-o-glucuronideorganic oxidearomatic heteropolycyclic compoundorganopnictogen compoundchromanepyran carboxylic acid or derivativeshydroxy acidcarboxamide groupoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyransecondary alcohol4'-hydroxyflavonoidbenzenoidorganic nitrogen compoundorganooxygen compound |
|---|