| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:53 UTC |
|---|
| Update Date | 2025-03-25 01:02:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253651 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H28N4O4S |
|---|
| Molecular Mass | 372.1831 |
|---|
| SMILES | O=C(CCCNC(=O)CCCCC1SCC2NC(=O)NC21)NCCO |
|---|
| InChI Key | AEDBUODGBKDWHJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | biotin and derivatives |
|---|
| Subclass | biotin and derivatives |
|---|
| Direct Parent | biotin and derivatives |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalkanolaminesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylthioethersgamma amino acids and derivativeshydrocarbon derivativesimidazolidinonesn-acyl aminesn-acylethanolaminesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amidesthienoimidazolidinesthiolanesthiophenes |
|---|
| Substituents | thiolaneimidazolidinefatty acylcarbonyl groupgamma amino acid or derivativesfatty amidethiophenecarboxylic acid derivativealiphatic heteropolycyclic compoundimidazolidinoneorganic oxidebiotin_derivativeorganonitrogen compoundorganopnictogen compoundalkanolaminealcoholcarbonic acid derivativeazacycledialkylthioetherthienoimidazolidinecarboxamide groupn-acylethanolaminen-acyl-aminesecondary carboxylic acid amideorganic oxygen compoundthioetherhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|