| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:54 UTC |
|---|
| Update Date | 2025-03-25 01:02:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253665 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H26O5 |
|---|
| Molecular Mass | 358.178 |
|---|
| SMILES | O=C(CCc1cccc(O)c1)CC(CO)C(CO)Cc1cccc(O)c1 |
|---|
| InChI Key | IMWFIWVOAZDZMB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | diarylheptanoids |
|---|
| Subclass | linear diarylheptanoids |
|---|
| Direct Parent | linear diarylheptanoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativesfatty alcoholshydrocarbon derivativesketonesorganic oxidesprimary alcohols |
|---|
| Substituents | alcoholfatty acylmonocyclic benzene moietycarbonyl group1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidketonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundfatty alcohollinear 1,7-diphenylheptane skeletonphenolhydrocarbon derivativebenzenoidprimary alcoholorganooxygen compound |
|---|