| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:56 UTC |
|---|
| Update Date | 2025-03-25 01:02:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253764 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H15NO4 |
|---|
| Molecular Mass | 309.1001 |
|---|
| SMILES | O=C(C=Cc1ccc(O)cc1)CC(=O)C=Cc1cccc(=O)[nH]1 |
|---|
| InChI Key | KWNYUDYUCPLLKP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | hydroxycinnamic acids and derivatives |
|---|
| Direct Parent | hydroxycinnamic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids2-halopyridinesacryloyl compoundsazacyclic compoundsbenzene and substituted derivativesenonesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesketoneslactamsorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyridinones |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouplactamaromatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidalpha,beta-unsaturated ketoneketoneorganic oxideorganonitrogen compoundorganopnictogen compound2-halopyridineorganoheterocyclic compoundenoneazacycleheteroaromatic compoundhydroxypyridinehydroxycinnamic acidpyridineorganic oxygen compoundphenolhydrocarbon derivativebenzenoidacryloyl-grouporganic nitrogen compoundpyridinoneorganooxygen compound |
|---|
