| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:57 UTC |
|---|
| Update Date | 2025-03-25 01:02:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253775 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H18N6O |
|---|
| Molecular Mass | 298.1542 |
|---|
| SMILES | Nc1ncnc2c1ncn2CC(O)C(N)Cc1ccccc1 |
|---|
| InChI Key | QGIOCYCHHHFWMU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylbutylamines |
|---|
| Direct Parent | phenylbutylamines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amphetamines and derivativesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonoalkylaminesn-substituted imidazolesorganopnictogen compoundspurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcohols |
|---|
| Substituents | imidazopyrimidinepyrimidinephenylbutylaminearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundamphetamine or derivativesazolen-substituted imidazolealcoholazacycleheteroaromatic compoundorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aliphatic amineprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|
