| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:22:59 UTC |
|---|
| Update Date | 2025-03-25 01:02:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253850 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H20N2O3 |
|---|
| Molecular Mass | 264.1474 |
|---|
| SMILES | CC(C)NCC(O)COc1cccc2c1CC(=O)N2 |
|---|
| InChI Key | NTSUZWFKLYJXNI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersamino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylamineshydrocarbon derivativesindolineslactamsorganic oxidesorganopnictogen compoundsphenol etherssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | phenol ethercarbonyl groupetherlactamamino acid or derivativesindolealkyl aryl ethercarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compounddihydroindolealcoholsecondary aliphatic amineazacyclesecondary aminecarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundamine |
|---|
