| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:23:02 UTC |
|---|
| Update Date | 2025-03-25 01:02:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253955 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H18N2O4S |
|---|
| Molecular Mass | 262.0987 |
|---|
| SMILES | CC(C)CC(NC(=S)NC(C)C(=O)O)C(=O)O |
|---|
| InChI Key | UTGRMDZRCWCDJG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | leucine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alanine and derivativesalpha amino acidscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesmethyl-branched fatty acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsthioureas |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupthioureacarboxylic acidmethyl-branched fatty acidfatty acidorganosulfur compoundbranched fatty acidorganic oxideorganic oxygen compoundleucine or derivativesorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundalanine or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|