| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:23:02 UTC |
|---|
| Update Date | 2025-03-25 01:02:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02253987 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H19N3O3 |
|---|
| Molecular Mass | 241.1426 |
|---|
| SMILES | CC(C)CC1NC(=O)CN(C(=O)C(C)N)C1=O |
|---|
| InChI Key | WUSJFEVJXLDTDS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | cyclic peptides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2,5-dioxopiperazinesalpha amino acid amidesalpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdicarboximidesdipeptideshydrocarbon derivativeslactamsmonoalkylaminesn-substituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl grouplactamalpha-amino acid or derivatives2,5-dioxopiperazineorganic oxidedioxopiperazinepiperazinealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximidecarboxylic acid imide, n-substitutedorganoheterocyclic compoundalpha-amino acid amideazacyclecarboxamide groupcarboxylic acid imidealpha-dipeptidesecondary carboxylic acid amideorganic oxygen compoundcyclic alpha peptide1,4-diazinanehydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
