| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:23:13 UTC |
|---|
| Update Date | 2025-03-25 01:02:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02254393 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H22O4 |
|---|
| Molecular Mass | 326.1518 |
|---|
| SMILES | CC(C)(C)c1cccc(C(=O)c2ccc(C(O)CC(=O)O)cc2)c1 |
|---|
| InChI Key | WSRGOPQSWYZIAY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsaryl ketonesaryl-phenylketonesbenzoyl derivativesbeta hydroxy acids and derivativescarboxylic acidsdiphenylmethaneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenylpropanesphenylpropanoic acidssecondary alcohols |
|---|
| Substituents | aromatic alcoholdiphenylmethanecarbonyl groupcarboxylic acid3-phenylpropanoic-acidbenzoylcarboxylic acid derivativebenzophenoneketonephenylpropanebeta-hydroxy acidorganic oxidealcoholaryl-phenylketonehydroxy acidaromatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compoundaryl ketone |
|---|
