| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:23:21 UTC |
|---|
| Update Date | 2025-03-25 01:02:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02254676 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C26H42O11 |
|---|
| Molecular Mass | 530.2727 |
|---|
| SMILES | CC12CCC(OC3OC(C(=O)O)C(O)C(O)C3O)CC1CC(O)C1C2CCC2(C)C1CCC2(O)C(O)O |
|---|
| InChI Key | PXDRFMDFLNUUBL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | steroidal glycosides |
|---|
| Direct Parent | steroid glucuronide conjugates |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 17-hydroxysteroids7-hydroxysteroidsacetalsandrostane steroidsbeta hydroxy acids and derivativescarbonyl compoundscarbonyl hydratescarboxylic acidscyclic alcohols and derivativesglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharideso-glucuronidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholstertiary alcohols |
|---|
| Substituents | 20-hydroxysteroidcarbonyl groupcarboxylic acidglucuronic acid or derivativescarbonyl hydrateo-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidealiphatic heteropolycyclic compoundbeta-hydroxy acidsaccharideorganic oxideacetaloxaneorganoheterocyclic compound17-hydroxysteroidalcoholpyran carboxylic acid or derivativeshydroxysteroidhydroxy acidcyclic alcohol7-hydroxysteroidoxacycletertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compoundandrostane-skeletonpyransecondary alcoholsteroid-glucuronide-skeletonhydrocarbon derivativeorganooxygen compound |
|---|