| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:23:21 UTC |
|---|
| Update Date | 2025-03-25 01:02:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02254697 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H18O2 |
|---|
| Molecular Mass | 230.1307 |
|---|
| SMILES | CC1=C(C)C(CC(=O)O)c2cc(C)c(C)cc21 |
|---|
| InChI Key | LHGBNBQVJYAACV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | indenes and isoindenes |
|---|
| Subclass | indenes and isoindenes |
|---|
| Direct Parent | indenes and isoindenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxides |
|---|
| Substituents | carbonyl grouporganic oxidemonocarboxylic acid or derivativesindenecarboxylic acidorganic oxygen compoundaromatic homopolycyclic compoundhydrocarbon derivativecarboxylic acid derivativeorganooxygen compound |
|---|
