| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:23:23 UTC |
|---|
| Update Date | 2025-03-25 01:02:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02254749 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H32O4 |
|---|
| Molecular Mass | 348.2301 |
|---|
| SMILES | CC12CCC(O)C(C)(C)C1CCC1=C2CCC2C1CCC2(O)C(=O)O |
|---|
| InChI Key | NVGJZNOQCUTGEA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | hydroxysteroids |
|---|
| Direct Parent | 17-hydroxysteroids |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 3-hydroxysteroidsalpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclic alcohols and derivativesditerpenoidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcoholstertiary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidabietane diterpenoidalpha-hydroxy acid3-hydroxysteroidhydroxy acidcyclic alcoholcarboxylic acid derivativealiphatic homopolycyclic compoundtertiary alcoholorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativediterpenoidorganooxygen compound17-hydroxysteroid |
|---|
