Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 15:42:07 UTC |
---|
Update Date | 2025-03-25 01:09:10 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02297461 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C40H66N3O33P |
---|
Molecular Mass | 1147.3316 |
---|
SMILES | CC(=O)NC1C(O)CC(OCC2C(O)C(O)C(OC3OC(CO)C(O)C(OC4(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O4)C3O)C(OC(=O)CCC(N)C(=O)O)C2OP(=O)(O)O)(C(=O)O)OC1C(O)C(O)CO |
---|
InChI Key | ZCCUEDCFXDJVGG-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | glutamic acid and derivatives |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | acetamidesalpha amino acidsc-glucuronidescarbonyl compoundscarboxylic acid esterscarboxylic acidscyclitols and derivativescyclohexanolsfatty acid estershydrocarbon derivativesketalsmonoalkyl phosphatesmonoalkylaminesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary carboxylic acid amidestetracarboxylic acids and derivatives |
---|
Substituents | fatty acylcarbonyl groupcarboxylic acidmonosaccharidepyran carboxylic acidsaccharideorganic oxideacetalketalaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidec-glucuronidealcoholpyran carboxylic acid or derivativescyclohexanolcyclitol or derivativestetracarboxylic acid or derivativesglutamic acid or derivativescyclic alcoholcarboxamide groupoxacyclesecondary carboxylic acid amidefatty acid esterorganic oxygen compoundphosphoric acid esterpyranmonoalkyl phosphatecarboxylic acid estersecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
---|