| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:42:21 UTC |
|---|
| Update Date | 2025-03-25 01:09:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02298011 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C31H53NO37S4 |
|---|
| Molecular Mass | 1159.1179 |
|---|
| SMILES | CC(=O)NC1C(OC2C(O)C(O)OC(COS(=O)(=O)O)C(O)C2O)OC(COS(=O)(=O)O)C(OC2OC(COS(=O)(=O)O)C(O)C(OC3(C(=O)O)OC(COS(C)(=O)=O)C(O)C(C(O)C(O)CO)O3)C2O)C1O |
|---|
| InChI Key | XEEAOLVDPQOGLU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-acyl-alpha-hexosamines |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanesacetalsacetamidesalkyl sulfatescarbonyl compoundscarboxylic acid orthoesterscarboxylic acidshemiacetalshydrocarbon derivativesmethanesulfonatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonic acid estersortho estersoxacyclic compoundsoxanesoxepanesprimary alcoholssecondary alcoholssecondary carboxylic acid amidessulfonic acid esterssulfonylssulfuric acid monoesters |
|---|
| Substituents | organosulfonic acid or derivativessulfuric acid monoestercarbonyl groupcarboxylic acidortho estermonosaccharidecarboxylic acid orthoesterorganosulfur compoundcarboxylic acid derivativen-acyl-alpha-hexosaminesulfonic acid esterorganic oxideacetalalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalorthocarboxylic acid derivativeoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholorganic sulfuric acid or derivativescarboxamide grouporganosulfonic acid estermethanesulfonateoxepaneoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativessulfonylorganic sulfonic acid or derivativessecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid estermeta-dioxane |
|---|