| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:43:04 UTC |
|---|
| Update Date | 2025-03-25 01:09:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02299650 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C35H60N2O25 |
|---|
| Molecular Mass | 908.3485 |
|---|
| SMILES | CC(=O)NC1C(O)C(OC2OC(CO)C(O)C(O)C2O)C(OC2OC(C)C(O)C(O)C2O)C(NC(C)=O)C1OC1C(O)C(CO)OC(OC2C(CO)OC(CO)C(O)C2O)C1O |
|---|
| InChI Key | LGQOMZSWUTWDTE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | streptamine aminoglycosides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidescarbonyl compoundscarboxylic acids and derivativescyclitols and derivativescyclohexanolsdialkyl ethershydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupethermonosaccharidecarboxylic acid derivativedialkyl etherorganic oxideacetalstreptamine aminoglycosidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholcyclohexanolcyclitol or derivativescyclic alcoholcarboxamide groupoxacyclesecondary carboxylic acid amidesecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
|---|
