| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:43:26 UTC |
|---|
| Update Date | 2025-03-25 01:09:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02300465 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C45H68N10O9 |
|---|
| Molecular Mass | 892.5171 |
|---|
| SMILES | CCC(C)C(NC(=O)C(NC(=O)C(N)CCCN=C(N)N)C(C)C)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(C(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)O)C(C)C |
|---|
| InChI Key | YLNPINYCDSUZGY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic polymers |
|---|
| Class | polypeptides |
|---|
| Subclass | polypeptides |
|---|
| Direct Parent | polypeptides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsamphetamines and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboximidamidescarboxylic acidsguanidineshydrocarbon derivativesisoleucine and derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesn-acyl-alpha amino acidsn-acylpyrrolidinesorganic oxidesorganopnictogen compoundspeptidesphenylalanine and derivativesphenylpropanoic acidsproline and derivativespropargyl-type 1,3-dipolar organic compoundspyrrolidinecarboxamidessecondary carboxylic acid amidestertiary carboxylic acid amidestyrosine and derivativesvaline and derivatives |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidalpha-amino acid or derivativesalpha peptideorganonitrogen compoundalpha-amino acidisoleucine or derivativesorganoheterocyclic compoundn-acyl-alpha amino acid or derivativespolypeptidetyrosine or derivativesalpha-amino acid amideazacyclen-acyl-alpha-amino acidvaline or derivativesorganic 1,3-dipolar compoundn-substituted-alpha-amino acidsecondary carboxylic acid amidepyrrolidine carboxylic acid or derivativesphenolhydrocarbon derivativeprimary aliphatic aminepyrrolidine-2-carboxamidefatty acylcarbonyl grouparomatic heteromonocyclic compound3-phenylpropanoic-acidguanidinefatty amiden-acylpyrrolidine1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundorganic oxidetertiary carboxylic acid amideorganopnictogen compoundpyrrolidineamphetamine or derivativesproline or derivativescarboximidamidecarboxamide groupn-acyl-aminemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundbenzenoidorganic nitrogen compoundorganooxygen compound |
|---|