DeepMet

Record Information
HMDB Status	Not Available
Creation Date	2024-02-21 15:43:28 UTC
Update Date	2025-03-25 01:09:40 UTC
HMDB ID	Not Available
Metabolite Identification
DeepMet ID	DMID02300568
Frequency	0.5
Structure
Chemical Formula	C₅₂H₈₃N₁₅O₁₁
Molecular Mass	1093.6396
SMILES	CCC(C)C(NC(C(=O)NC(CCCNC(=N)N)C(=O)O)C(C)CC)C(=O)NC(=O)C(CCCNC(=N)N)NC(=O)C(CC(C)C)NC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)C(N)Cc1ccc(O)cc1
InChI Key	VWHAYBYERBSZEV-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic polymers
Class	polypeptides
Subclass	polypeptides
Direct Parent	polypeptides
Geometric Descriptor	aromatic homomonocyclic compounds
Alternative Parents	1-hydroxy-2-unsubstituted benzenoids alpha amino acid amides alpha amino acids amino acids amphetamines and derivatives arginine and derivatives benzene and substituted derivatives carbonyl compounds carboximidamides carboxylic acids dialkylamines dicarboximides guanidines hydrocarbon derivatives imines isoleucine and derivatives leucine and derivatives monoalkylamines monocarboxylic acids and derivatives n-acyl amines n-acyl-alpha amino acids n-unsubstituted carboxylic acid imides organic oxides organopnictogen compounds peptides phenylalanine and derivatives secondary carboxylic acid amides tyrosine and derivatives
Substituents	fatty acyl monocyclic benzene moiety carbonyl group carboxylic acid amino acid or derivatives amino acid guanidine imine fatty amide 1-hydroxy-2-unsubstituted benzenoid alpha-amino acid or derivatives carboxylic acid derivative alpha peptide carboxylic acid imide, n-unsubstituted organic oxide arginine or derivatives leucine or derivatives organonitrogen compound alpha-amino acid organopnictogen compound dicarboximide isoleucine or derivatives amphetamine or derivatives n-acyl-alpha amino acid or derivatives secondary aliphatic amine polypeptide tyrosine or derivatives alpha-amino acid amide n-acyl-alpha-amino acid carboximidamide secondary amine carboxamide group n-acyl-amine n-substituted-alpha-amino acid carboxylic acid imide aromatic homomonocyclic compound secondary carboxylic acid amide monocarboxylic acid or derivatives phenylalanine or derivatives organic oxygen compound phenol hydrocarbon derivative benzenoid primary aliphatic amine organic nitrogen compound organooxygen compound amine

Showing information for DMID02300568