| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:46:50 UTC |
|---|
| Update Date | 2025-03-25 01:10:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02308446 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H39NO27S4 |
|---|
| Molecular Mass | 877.0592 |
|---|
| SMILES | COC1C(COS(=O)(=O)O)OC(OC2C(O)C(COS(=O)(=O)O)C(O)C(OC3OC(COS(=O)(=O)O)CC(O)C3NC(C)=O)C2O)C(OS(=O)(=O)O)C1O |
|---|
| InChI Key | BKBGLYSCQMFAKA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesalkyl sulfatescarbonyl compoundscarboxylic acids and derivativescyclitols and derivativesdialkyl ethershydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanessecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarbonyl groupethermonosaccharidecarboxylic acid derivativedialkyl ethersaccharideorganic oxideacetalalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundacetamideorganic sulfuric acid or derivativescyclohexanolcyclitol or derivativescyclic alcoholcarboxamide groupoxacyclesecondary carboxylic acid amidesulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid ester |
|---|