| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:50:19 UTC |
|---|
| Update Date | 2025-03-25 01:12:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02316646 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C53H73N11O14 |
|---|
| Molecular Mass | 1087.5338 |
|---|
| SMILES | CCC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(=O)O)C(C)C)C(=O)NC(=O)C(=O)N1CCCC1C(Cc1ccc(O)cc1)NC(Cc1ccc(O)cc1)C(=O)O |
|---|
| InChI Key | SQPNUIAPYNFXNT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | oligopeptides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsamino acidsamphetamines and derivativesaspartic acid and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboximidamidescarboxylic acidsdialkylaminesdicarboximidesdicarboxylic acids and derivativesguanidineshydrocarbon derivativesisoleucine and derivativesmonoalkylaminesn-acyl aminesn-acyl-alpha amino acidsn-acylpyrrolidinesn-unsubstituted carboxylic acid imidesorganic oxidesorganopnictogen compoundsphenylalanine and derivativesphenylpropanoic acidspropargyl-type 1,3-dipolar organic compoundssecondary carboxylic acid amidestertiary carboxylic acid amidestyrosine and derivativesvaline and derivatives |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidamino acid or derivativesalpha-amino acid or derivativescarboxylic acid imide, n-unsubstitutedorganonitrogen compoundalpha-amino acidisoleucine or derivativesorganoheterocyclic compoundn-acyl-alpha amino acid or derivativessecondary aliphatic aminetyrosine or derivativesalpha-amino acid amideazacyclen-acyl-alpha-amino acidvaline or derivativesorganic 1,3-dipolar compoundn-substituted-alpha-amino acidcarboxylic acid imidesecondary carboxylic acid amideaspartic acid or derivativesdicarboxylic acid or derivativesphenolhydrocarbon derivativeprimary aliphatic amineaminefatty acylcarbonyl grouparomatic heteromonocyclic compound3-phenylpropanoic-acidamino acidguanidinefatty amiden-acylpyrrolidine1-hydroxy-2-unsubstituted benzenoidpropargyl-type 1,3-dipolar organic compoundorganic oxidetertiary carboxylic acid amideorganopnictogen compounddicarboximidepyrrolidineamphetamine or derivativescarboximidamidesecondary aminecarboxamide groupn-acyl-aminephenylalanine or derivativesorganic oxygen compoundbenzenoidalpha-oligopeptideorganic nitrogen compoundorganooxygen compound |
|---|