| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:51:01 UTC |
|---|
| Update Date | 2025-03-25 01:12:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02318291 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C40H62N12O12 |
|---|
| Molecular Mass | 902.461 |
|---|
| SMILES | CCC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(=O)O)C(C)C)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(C(=O)O)C(C)O |
|---|
| InChI Key | SVIVWRZPCHJVKL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic polymers |
|---|
| Class | polypeptides |
|---|
| Subclass | polypeptides |
|---|
| Direct Parent | polypeptides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsamphetamines and derivativesaspartic acid and derivativesazacyclic compoundsbenzene and substituted derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboximidamidescarboxylic acidsdicarboxylic acids and derivativesguanidinesheteroaromatic compoundshydrocarbon derivativesimidazolesisoleucine and derivativesmonoalkylaminesn-acyl aminesn-acyl-alpha amino acidsorganic oxidesorganopnictogen compoundspeptidesphenylalanine and derivativespropargyl-type 1,3-dipolar organic compoundssecondary alcoholssecondary carboxylic acid amidestyrosine and derivativesvaline and derivatives |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidalpha-amino acid or derivativesalpha peptidebeta-hydroxy acidorganonitrogen compoundalpha-amino acidisoleucine or derivativesorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesalcoholpolypeptidetyrosine or derivativesalpha-amino acid amideazacyclen-acyl-alpha-amino acidvaline or derivativesheteroaromatic compoundorganic 1,3-dipolar compoundn-substituted-alpha-amino acidsecondary carboxylic acid amideaspartic acid or derivativesdicarboxylic acid or derivativesphenolhydrocarbon derivativeprimary aliphatic aminefatty acylcarbonyl grouparomatic heteromonocyclic compoundguanidinefatty amide1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundorganic oxideimidazoleorganopnictogen compoundamphetamine or derivativesazolecarboximidamidehydroxy acidcarboxamide groupn-acyl-aminephenylalanine or derivativesorganic oxygen compoundsecondary alcoholbenzenoidorganic nitrogen compoundorganooxygen compound |
|---|