| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:54:25 UTC |
|---|
| Update Date | 2025-03-25 01:13:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02326042 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C38H62N2O30 |
|---|
| Molecular Mass | 1026.3387 |
|---|
| SMILES | CC(=O)NC1C(O)CC(OC2CC(OC3C(O)C(CO)OC(OC(C(O)CO)C(O)C(O)C=O)C3O)(C(=O)O)C(NC(C)=O)C(OC3OC(CO)C(O)C(O)C3O)C2O)(C(=O)O)OC1C(O)C(O)CO |
|---|
| InChI Key | GPYUATZPWBYFLK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | tannins |
|---|
| Subclass | hydrolyzable tannins |
|---|
| Direct Parent | hydrolyzable tannins |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl glycosidesalpha-hydroxyaldehydesbeta-hydroxy aldehydesc-glucuronidescarboxylic acidscyclohexanolsdialkyl ethersdicarboxylic acids and derivativesfatty acyl glycosides of mono- and disaccharideshydrocarbon derivativesketalsmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidsquinic acids and derivativessecondary carboxylic acid amides |
|---|
| Substituents | fatty acylfatty acyl glycoside of mono- or disaccharidebeta-hydroxy aldehydecarbonyl groupethercarboxylic acidmonosaccharidecarboxylic acid derivativepyran carboxylic aciddialkyl ethersaccharideorganic oxidealpha-hydroxyaldehydeacetalketalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidehydrolyzable tanninc-glucuronidealcoholpyran carboxylic acid or derivativesfatty acyl glycosidecyclohexanolaldehydecyclitol or derivativescyclic alcoholcarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundpyransecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundalkyl glycosidequinic acid |
|---|