| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:56:18 UTC |
|---|
| Update Date | 2025-03-25 01:14:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02330422 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C47H83N5O6PS+ |
|---|
| Molecular Mass | 876.5796 |
|---|
| SMILES | CCCCCCC=CCCCCCCCC(=O)NC(COP(=O)(O)OCCc1sc[n+](Cc2cnc(C)nc2N)c1C)C(O)CCCCCCCC=CCCCCCCC |
|---|
| InChI Key | WFPPCMLHVZRKFM-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | thiamine phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 4,5-disubstituted thiazolesamino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkyl phosphatesheteroaromatic compoundshydrocarbon derivativesimidolactamsn-acyl aminesorganic cationsorganic oxidesorganopnictogen compoundsphosphoethanolaminesprimary aminessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylcarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesfatty amidecarboxylic acid derivativephosphoethanolamineorganic oxideorganonitrogen compoundorganopnictogen compoundorganic cationimidolactamthiamine-phosphateazolealcoholazacycleheteroaromatic compoundcarboxamide groupn-acyl-amine4,5-disubstituted 1,3-thiazolesecondary carboxylic acid amidedialkyl phosphateorganic oxygen compoundphosphoric acid estersecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundthiazoleorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|