| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:56:19 UTC |
|---|
| Update Date | 2025-03-25 01:14:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02330478 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C54H98N3O10PS |
|---|
| Molecular Mass | 1011.6711 |
|---|
| SMILES | CCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OCC(NC(=O)CCCCCCCC=CCCCCCC)C(O)CCCCCCCC=CCCCCCCC |
|---|
| InChI Key | LCFWDCBMCQFBGR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | beta amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarbothioic s-esterscarboxylic acids and derivativesdialkyl phosphatesfatty acyl thioestershydrocarbon derivativesmonosaccharidesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphosphoethanolaminessecondary alcoholssecondary carboxylic acid amidessulfenyl compoundsthioestersthiolactones |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupfatty amidemonosaccharideorganosulfur compoundcarbothioic s-esterphosphoethanolaminesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundfatty acyl thioesterthiolactonealcoholthiocarboxylic acid or derivativessulfenyl compoundthiocarboxylic acid estercarboxamide groupn-acyl-aminebeta amino acid or derivativessecondary carboxylic acid amidedialkyl phosphateorganic oxygen compoundphosphoric acid estersecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
