DeepMet

Record Information
HMDB Status	Not Available
Creation Date	2024-02-21 15:57:10 UTC
Update Date	2025-03-25 01:15:03 UTC
HMDB ID	Not Available
Metabolite Identification
DeepMet ID	DMID02332562
Frequency	0.5
Structure
Chemical Formula	C₂₆H₄₃NO₃₀S₃
Molecular Mass	945.1032
SMILES	COC1C(C(=O)O)OC(OC2C(COS(=O)(=O)O)OC(OC3C(O)C(COS(=O)(=O)O)OC(OC(C(O)C=O)C(O)CO)C3O)C(NC(C)=O)C2O)C(OS(=O)(=O)O)C1O
InChI Key	YTUDDKFSKDRAGV-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic oxygen compounds
Class	organooxygen compounds
Subclass	carbohydrates and carbohydrate conjugates
Direct Parent	n-acyl-alpha-hexosamines
Geometric Descriptor	aliphatic heteromonocyclic compounds
Alternative Parents	acetals acetamides alkyl sulfates alpha-hydroxyaldehydes carboxylic acids dialkyl ethers glucuronic acid derivatives hydrocarbon derivatives monocarboxylic acids and derivatives monosaccharides o-glucuronides organic oxides organonitrogen compounds organopnictogen compounds oxacyclic compounds oxanes primary alcohols pyran carboxylic acids secondary alcohols secondary carboxylic acid amides sulfuric acid monoesters
Substituents	sulfuric acid monoester carbonyl group ether carboxylic acid glucuronic acid or derivatives o-glucuronide monosaccharide carboxylic acid derivative pyran carboxylic acid dialkyl ether n-acyl-alpha-hexosamine 1-o-glucuronide organic oxide alpha-hydroxyaldehyde acetal alkyl sulfate aliphatic heteromonocyclic compound organonitrogen compound organopnictogen compound oxane primary alcohol organoheterocyclic compound acetamide alcohol pyran carboxylic acid or derivatives organic sulfuric acid or derivatives aldehyde carboxamide group oxacycle secondary carboxylic acid amide monocarboxylic acid or derivatives pyran secondary alcohol sulfate-ester hydrocarbon derivative organic nitrogen compound sulfuric acid ester

Showing information for DMID02332562