| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:57:13 UTC |
|---|
| Update Date | 2025-03-25 01:15:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02332653 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C56H111N3O6P+ |
|---|
| Molecular Mass | 952.8205 |
|---|
| SMILES | CCCCCCC=CCCCCCCCC(=O)NC(CCCCCCCC=CCCCCCC)NC(COP(=O)(O)OCC[N+](C)(C)C)C(O)CCCCCCCC=CCCCCCCC |
|---|
| InChI Key | UVAWQYFAJRVZKO-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | quaternary ammonium salts |
|---|
| Direct Parent | phosphocholines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | amino acids and derivativescarbonyl compoundscarboxylic acids and derivativesdialkyl phosphatesdialkylamineshydrocarbon derivativesn-acyl aminesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsphosphoethanolaminessecondary alcoholssecondary carboxylic acid amidestetraalkylammonium salts |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupamino acid or derivativesfatty amidecarboxylic acid derivativephosphoethanolamineorganic oxideorganopnictogen compoundorganic cationorganic saltalcoholsecondary aliphatic aminetetraalkylammonium saltsecondary aminecarboxamide groupn-acyl-aminephosphocholinesecondary carboxylic acid amidedialkyl phosphateorganic oxygen compoundphosphoric acid estersecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|