| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 16:00:14 UTC |
|---|
| Update Date | 2025-03-25 01:16:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02339879 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C41H65N13O10 |
|---|
| Molecular Mass | 899.4977 |
|---|
| SMILES | CC(C)CC(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(NC(=O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(=O)O)C(C)C)C(C)C)C(N)=O |
|---|
| InChI Key | SODXZCKFLAMUCK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic polymers |
|---|
| Class | polypeptides |
|---|
| Subclass | polypeptides |
|---|
| Direct Parent | polypeptides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsamphetamines and derivativesaspartic acid and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboximidamidescarboxylic acidsguanidinesheteroaromatic compoundshydrocarbon derivativesimidazolesleucine and derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesn-acyl-alpha amino acidsorganic oxidesorganopnictogen compoundspeptidesphenylalanine and derivativesprimary carboxylic acid amidespropargyl-type 1,3-dipolar organic compoundssecondary carboxylic acid amidestyrosine and derivativesvaline and derivatives |
|---|
| Substituents | primary carboxylic acid amidefatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundguanidinefatty amide1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativescarboxylic acid derivativealpha peptidepropargyl-type 1,3-dipolar organic compoundorganic oxideimidazoleleucine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundamphetamine or derivativesazolen-acyl-alpha amino acid or derivativespolypeptidetyrosine or derivativesalpha-amino acid amideazacyclen-acyl-alpha-amino acidvaline or derivativesheteroaromatic compoundorganic 1,3-dipolar compoundcarboximidamidecarboxamide groupn-acyl-aminen-substituted-alpha-amino acidsecondary carboxylic acid amidemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundaspartic acid or derivativesphenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|