| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 16:12:37 UTC |
|---|
| Update Date | 2025-03-25 01:20:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02367939 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C43H47N5O17 |
|---|
| Molecular Mass | 905.2967 |
|---|
| SMILES | CC1=C(CCC(=O)O)c2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)c(CC(=O)O)c5CCC(=O)O)C(CCC(=O)O)=C4CC(=O)O)c(C1OC(CO)C(O)C(O)C1O)c3CC(N)C(=O)O |
|---|
| InChI Key | NTXOYUKICWNILJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | tetrapyrroles and derivatives |
|---|
| Subclass | metallotetrapyrroles |
|---|
| Direct Parent | metallotetrapyrroles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsdialkyl ethersheteroaromatic compoundshexacarboxylic acids and derivativeshydrocarbon derivativesmonoalkylaminesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyrrolessecondary alcohols |
|---|
| Substituents | carbonyl groupethercarboxylic acidmonosaccharidealpha-amino acid or derivativescarboxylic acid derivativedialkyl ethersaccharideorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundoxanemetallotetrapyrrole skeletonhexacarboxylic acid or derivativesprimary alcoholalcoholazacycleheteroaromatic compoundoxacycleorganic oxygen compoundpyrrolesecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
