| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 16:14:41 UTC |
|---|
| Update Date | 2025-03-25 01:21:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02372754 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C57H111N3O6P+ |
|---|
| Molecular Mass | 964.8205 |
|---|
| SMILES | CCCCCCC=CCCCCCCCC(=O)NC(COP(=O)(NC(=O)CCCCCCCC=CCCCCCC)OCC[N+](C)(C)C)C(O)CCCCCCCC=CCCCCCCCC |
|---|
| InChI Key | VNJPCIVEADXXPF-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty amides |
|---|
| Direct Parent | n-acyl amines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | aminescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsphosphate esterssecondary alcoholssecondary carboxylic acid amidestetraalkylammonium salts |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundorganic cationorganic saltalcoholtetraalkylammonium saltquaternary ammonium saltcarboxamide groupn-acyl-aminesecondary carboxylic acid amideorganic oxygen compoundphosphoric acid estersecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeamineorganooxygen compound |
|---|