| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 16:31:26 UTC |
|---|
| Update Date | 2025-03-25 01:27:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02412114 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C34H57NO28 |
|---|
| Molecular Mass | 927.3067 |
|---|
| SMILES | CC(=O)NC1CC(OCC2OC(OC3C(CO)OC(OC4C(O)C(CO)OC(OC(C(O)CO)C(O)C(O)C=O)C4O)OC3CO)C(O)C(O)C2O)(C(=O)O)OC1C(O)C(O)CO |
|---|
| InChI Key | CJZDRVMHXLHCNY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acyl glycosides |
|---|
| Direct Parent | fatty acyl glycosides of mono- and disaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanesacetamidesalkyl glycosidesalpha-hydroxyaldehydesbeta-hydroxy aldehydescarboxylic acid orthoesterscarboxylic acidsgamma amino acids and derivativeshydrocarbon derivativesketalsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsortho estersoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | fatty acyl glycoside of mono- or disaccharidebeta-hydroxy aldehydecarbonyl groupcarboxylic acidortho estergamma amino acid or derivativesmonosaccharidecarboxylic acid orthoestercarboxylic acid derivativesaccharideorganic oxidealpha-hydroxyaldehydeacetalketalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundorthocarboxylic acid derivativeoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholtetrahydrofuranaldehydecarboxamide groupoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundmeta-dioxaneorganooxygen compoundalkyl glycoside |
|---|