| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 16:51:07 UTC |
|---|
| Update Date | 2025-03-25 01:36:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02457969 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C42H59N11O13S4 |
|---|
| Molecular Mass | 1053.3177 |
|---|
| SMILES | COc1ccc(CC2NC(=O)C(N)CSSCC(C(=O)O)NC(=O)C(Cc3ccc(O)cc3)NC(=O)C(N)CSSCC(C(=O)N3CCCC3C(=O)NC(CCCNC(=N)N)C(=O)O)NC2=O)cc1O |
|---|
| InChI Key | KHZCTUAMBZDKIZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic polymers |
|---|
| Class | polypeptides |
|---|
| Subclass | polypeptides |
|---|
| Direct Parent | polypeptides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersalpha amino acid amidesalpha amino acidsanisolesarginine and derivativesazacyclic compoundscarbonyl compoundscarboximidamidescarboxylic acidscyclic peptidesdicarboxylic acids and derivativesguanidineshydrocarbon derivativesimineslactamsmethoxybenzenesmethoxyphenolsmonoalkylaminesn-acyl-alpha amino acidsn-acylpyrrolidinesorganic disulfidesorganic oxidesorganopnictogen compoundsphenoxy compoundsproline and derivativespyrrolidinecarboxamidessecondary carboxylic acid amidestertiary carboxylic acid amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietylactamcarboxylic acidmethoxyphenolalpha-amino acid or derivativesorganonitrogen compoundalpha-amino acidorganoheterocyclic compoundn-acyl-alpha amino acid or derivativespolypeptidealpha-amino acid amideazacyclen-acyl-alpha-amino acidmethoxybenzenesecondary carboxylic acid amidepyrrolidine carboxylic acid or derivativesanisoleorganic disulfidedicarboxylic acid or derivativesphenolhydrocarbon derivativeprimary aliphatic aminepyrrolidine-2-carboxamidephenoxy compoundcarbonyl groupetheraromatic heteromonocyclic compoundguanidineiminen-acylpyrrolidine1-hydroxy-2-unsubstituted benzenoidalkyl aryl ethercarboxylic acid derivativeorganic oxidearginine or derivativestertiary carboxylic acid amideorganopnictogen compoundpyrrolidineproline or derivativescarboximidamide1-hydroxy-4-unsubstituted benzenoidcarboxamide grouporganic oxygen compoundcyclic alpha peptidebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|