| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 16:54:45 UTC |
|---|
| Update Date | 2025-03-25 01:37:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02466612 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C53H101N2O8P |
|---|
| Molecular Mass | 924.7296 |
|---|
| SMILES | CCCCCCC=CCCCCCCCC(=O)NC(O)COP(=O)(O)OCC(NC(=O)CCCCCCCC=CCCCCCC)C(O)CCCCCCCC=CCCCCCCC |
|---|
| InChI Key | ZODSREFSVVFARA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | phosphoethanolamines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkanolaminescarbonyl compoundscarboxylic acids and derivativesdialkyl phosphateshydrocarbon derivativesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | alcoholfatty acylaliphatic acyclic compoundcarbonyl groupfatty amidecarboxamide groupcarboxylic acid derivativen-acyl-aminesecondary carboxylic acid amidedialkyl phosphatephosphoethanolamineorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundalkyl phosphateorganooxygen compoundalkanolamine |
|---|
