| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 16:55:52 UTC |
|---|
| Update Date | 2025-03-25 01:38:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02469199 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C41H83NO26P6 |
|---|
| Molecular Mass | 1191.3629 |
|---|
| SMILES | CCCCCCC=CCCCCCCCC(=O)NC(COP(=O)(O)OC1C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C1OP(=O)(O)O)C(O)CCCCCCCC=CCCCCCCC |
|---|
| InChI Key | OHLWRUSUQWXILF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | inositol phosphates |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativesdialkyl phosphateshydrocarbon derivativesmonoalkyl phosphatesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphosphoethanolaminessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylcarbonyl groupfatty amideinositol phosphatecarboxylic acid derivativephosphoethanolamineorganic oxideorganonitrogen compoundorganopnictogen compoundcarboxamide groupn-acyl-aminesecondary carboxylic acid amidedialkyl phosphatephosphoric acid estermonoalkyl phosphatesecondary alcoholaliphatic homomonocyclic compoundhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
