| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 17:05:11 UTC | 
|---|
| Update Date | 2025-03-25 01:42:17 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID02491209 | 
|---|
| Frequency | 0.5 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C38H64N2O30 | 
|---|
| Molecular Mass | 1028.3544 | 
|---|
| SMILES | CC(=O)NC1C(OC2C(O)C(CO)OC(OC(C(O)CO)C(C(O)C=O)C(O)CO)C2O)OC(O)C(OC2OC(COC3(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O3)C(O)C(O)C2O)C1O | 
|---|
| InChI Key | HJRLXHFSJBCBDK-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | lipids and lipid-like molecules | 
|---|
| Class | fatty acyls | 
|---|
| Subclass  | fatty acyl glycosides | 
|---|
| Direct Parent  | fatty acyl glycosides of mono- and disaccharides | 
|---|
| Geometric Descriptor  | aliphatic heteromonocyclic compounds | 
|---|
| Alternative Parents  | acetamidesalkyl glycosidesalpha-hydroxyaldehydesc-glucuronidescarboxylic acidshemiacetalshydrocarbon derivativesketalsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcoholssecondary carboxylic acid amides | 
|---|
| Substituents  | fatty acyl glycoside of mono- or disaccharidecarbonyl groupcarboxylic acidmonosaccharidecarboxylic acid derivativepyran carboxylic acidsaccharideorganic oxidealpha-hydroxyaldehydeacetalketalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundacetamidec-glucuronidealcoholpyran carboxylic acid or derivativesaldehydecarboxamide groupoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundpyransecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundalkyl glycoside | 
|---|