| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 17:06:18 UTC |
|---|
| Update Date | 2025-03-25 01:42:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02493641 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C32H52N7O15P3S |
|---|
| Molecular Mass | 899.2455 |
|---|
| SMILES | CCCC=CC=CC(=O)SCCNC(C)(C)CCNC(=O)C(=O)C(C)(C)COP(=O)(O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C(O)C1CP(=O)(O)O |
|---|
| InChI Key | KGYHFMVLVVWINO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleotides |
|---|
| Subclass | purine deoxyribonucleotides |
|---|
| Direct Parent | purine 3'-deoxyribonucleoside diphosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundscarbothioic s-esterscarboxylic acids and derivativesdialkylaminesfatty acyl thioestersheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsketonesmonoalkyl phosphatesn-acyl aminesn-substituted imidazolesorganic oxidesorganic phosphonic acids and derivativesorganic pyrophosphatesorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundspentose phosphatesprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholssecondary carboxylic acid amidessulfenyl compoundstetrahydrofuransthioestersthiolactones |
|---|
| Substituents | amino acid or derivativesimidazopyrimidinecarbothioic s-esterketoneorganonitrogen compoundorganophosphorus compoundorganophosphonic acid derivativeorganoheterocyclic compoundalcoholsecondary aliphatic aminesulfenyl compoundazacyclethiocarboxylic acid esterheteroaromatic compoundpurine 3'-deoxyribonucleoside diphosphateorganic pyrophosphatesecondary carboxylic acid amidemonoalkyl phosphatehydrocarbon derivativeprimary amineaminefatty acylcarbonyl grouppentose phosphatefatty amideorganosulfur compoundcarboxylic acid derivativepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganopnictogen compoundimidolactamfatty acyl thioesterthiolactoneazolen-substituted imidazolethiocarboxylic acid or derivativestetrahydrofuransecondary aminecarboxamide groupn-acyl-amineoxacycleorganic oxygen compoundphosphoric acid estersecondary alcoholpurineorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|