| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 17:09:12 UTC |
|---|
| Update Date | 2025-03-25 01:43:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02500546 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C47H59N11O12S2 |
|---|
| Molecular Mass | 1033.3786 |
|---|
| SMILES | N=C(NC(Cc1ccc(O)cc1)C(=O)O)C1CCCN1C(=O)C1CSSCC(N)C(=O)NC(Cc2ccc(O)cc2)C(=O)NC(Cc2ccccc2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(N)=O)C(=O)N1 |
|---|
| InChI Key | SJKKZIKHCLEPGF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic polymers |
|---|
| Class | polypeptides |
|---|
| Subclass | polypeptides |
|---|
| Direct Parent | polypeptides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acidsamidinesamphetamines and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboximidamidescarboxylic acidscyclic peptidesfatty amideshydrocarbon derivativeslactamsmacrolactamsmonoalkylaminesmonocarboxylic acids and derivativesn-acylpyrrolidinesorganic disulfidesorganic oxidesorganopnictogen compoundsphenylalanine and derivativesphenylpropanoic acidsprimary carboxylic acid amidessecondary carboxylic acid amidestertiary carboxylic acid amidestyrosine and derivatives |
|---|
| Substituents | primary carboxylic acid amidefatty acylmonocyclic benzene moietycarbonyl grouplactamcarboxylic acidaromatic heteromonocyclic compound3-phenylpropanoic-acidfatty amiden-acylpyrrolidine1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativesamidinecarboxylic acid derivativemacrolactamorganic oxidetertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundpyrrolidineorganoheterocyclic compoundamphetamine or derivativespolypeptidetyrosine or derivativesazacyclecarboximidamidecarboxamide groupsecondary carboxylic acid amidemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundcyclic alpha peptideorganic disulfidephenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|