| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 17:13:18 UTC | 
|---|
| Update Date | 2025-03-25 01:45:40 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID02510055 | 
|---|
| Frequency | 0.5 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C39H67NO30 | 
|---|
| Molecular Mass | 1029.3748 | 
|---|
| SMILES | CC(=O)NC1C(OCC2OC(CO)C(O)C(OC3OC(CO)C(O)C(OC4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)C3O)C2O)OC(CO)C(OC2OC(CO)C(O)C(O)C2O)C1O | 
|---|
| InChI Key | KHIHNOXSTPPTAH-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organic oxygen compounds | 
|---|
| Class | organooxygen compounds | 
|---|
| Subclass | carbohydrates and carbohydrate conjugates | 
|---|
| Direct Parent | n-acyl-alpha-hexosamines | 
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds | 
|---|
| Alternative Parents | acetalsacetamidescarbonyl compoundscarboxylic acids and derivativesdialkyl ethershydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amides | 
|---|
| Substituents | carbonyl groupethermonosaccharidecarboxylic acid derivativedialkyl ethern-acyl-alpha-hexosamineorganic oxideacetalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholcarboxamide groupoxacyclesecondary carboxylic acid amidesecondary alcoholhydrocarbon derivativeorganic nitrogen compound | 
|---|