| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 17:17:40 UTC |
|---|
| Update Date | 2025-03-25 01:47:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02520085 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C40H70N2O29 |
|---|
| Molecular Mass | 1042.4064 |
|---|
| SMILES | CC(=O)NC1C(OC2C(CO)OC(OC3C(O)C(CO)OC(OC(C(O)CO)C(O)C(O)C=O)C3O)C(N(C)C)C2O)OC(CO)C(OC2OC(CO)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O |
|---|
| InChI Key | LHJFOAHWLXRQTI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | aminoglycosides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsacetalsacetamidesalkyl glycosidesalpha-hydroxyaldehydesamino acids and derivativesbeta-hydroxy aldehydescarboxylic acids and derivativesfatty acyl glycosides of mono- and disaccharideshydrocarbon derivativesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amidestrialkylamines |
|---|
| Substituents | fatty acylfatty acyl glycoside of mono- or disaccharidebeta-hydroxy aldehydecarbonyl groupamino acid or derivativesmonosaccharidecarboxylic acid derivativen-acyl-alpha-hexosamineorganic oxidealpha-hydroxyaldehydeacetalaliphatic heteromonocyclic compoundorganonitrogen compoundaminoglycoside coreorganopnictogen compoundoxaneprimary alcoholtertiary amineorganoheterocyclic compoundacetamidealcoholfatty acyl glycoside1,2-aminoalcoholtertiary aliphatic aminealdehydecarboxamide groupoxacyclesecondary carboxylic acid amidesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundaminealkyl glycoside |
|---|
