| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 17:18:46 UTC |
|---|
| Update Date | 2025-03-25 01:47:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02522583 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C37H64N2O27 |
|---|
| Molecular Mass | 968.3696 |
|---|
| SMILES | CC(=O)NC1C(OC2OC(OC3C(CO)OC(O)C(O)C3O)OC(CO)C2O)C(O)C(OC2CC(O)C(NC(C)=O)C(C(O)C(O)CO)C2CO)C(O)C1OC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | WWJRPAIQJYFVCJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanesacetalsacetamidescarbonyl compoundscarboxylic acid orthoesterscarboxylic acids and derivativescyclitols and derivativesdialkyl ethershemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsortho estersoxacyclic compoundsoxanesprimary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupetherortho estermonosaccharidecarboxylic acid orthoestercarboxylic acid derivativedialkyl ethersaccharideorganic oxideacetalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalorthocarboxylic acid derivativeoxaneprimary alcoholorganoheterocyclic compoundacetamidecyclohexanolcyclitol or derivativescyclic alcoholcarboxamide groupoxacyclesecondary carboxylic acid amidehydrocarbon derivativeorganic nitrogen compoundmeta-dioxane |
|---|