| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 17:19:45 UTC |
|---|
| Update Date | 2025-03-25 01:48:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02524878 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C44H75NO34 |
|---|
| Molecular Mass | 1161.417 |
|---|
| SMILES | CC(=O)NC1C(CO)C(O)C(O)C(O)C1OC1C(O)C(OC2OC(COC3OC(CO)C(OC4OC(CO)C(O)C(O)C4O)C(OC4OC(CO)C(O)C(O)C4O)C(CO)O3)C2O)OC(CO)C1OC1OC(C)C(O)C(O)C1O |
|---|
| InChI Key | QVJVOJSLLVVSBL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | dioxepanes |
|---|
| Subclass | 1,3-dioxepanes |
|---|
| Direct Parent | 1,3-dioxepanes |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidescarbonyl compoundscarboxylic acid orthoesterscarboxylic acids and derivativescyclitols and derivativescyclohexanolsdialkyl ethershydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsortho estersoxacyclic compoundsoxanesoxetanesprimary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | 1,3-dioxepanecarbonyl groupetherortho estermonosaccharidecarboxylic acid orthoestercarboxylic acid derivativedialkyl ethersaccharideorganic oxideacetalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundorthocarboxylic acid derivativeoxaneprimary alcoholacetamidealcoholcyclohexanolcyclitol or derivativescyclic alcoholcarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundoxetanesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|