| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 17:21:58 UTC |
|---|
| Update Date | 2025-03-25 01:49:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02529778 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C46H78N2O37 |
|---|
| Molecular Mass | 1250.4283 |
|---|
| SMILES | CC(=O)NC1C(OC2C(O)C(COC3C(CO)OC(OC4OC(CO)C(O)C(O)C4O)(OC4C(CO)OC(O)C(O)C4O)C(O)C3NC(C)=O)OC(OC(C(O)CO)C(O)C(O)C=O)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | NMQNFOAZWHWFCW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-acyl-alpha-hexosamines |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesalkyl glycosidesalpha-hydroxyaldehydesbeta-hydroxy aldehydescarboxylic acid orthoesterscarboxylic acids and derivativesdialkyl ethersfatty acyl glycosides of mono- and disaccharideshemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsortho estersoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylfatty acyl glycoside of mono- or disaccharidebeta-hydroxy aldehydecarbonyl groupetherortho estermonosaccharidecarboxylic acid orthoestercarboxylic acid derivativedialkyl ethern-acyl-alpha-hexosamineorganic oxidealpha-hydroxyaldehydeacetalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalorthocarboxylic acid derivativeoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholfatty acyl glycosidealdehydecarboxamide groupoxacyclesecondary carboxylic acid amidesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundalkyl glycoside |
|---|
