Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 17:22:49 UTC |
---|
Update Date | 2025-03-25 01:49:38 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02531758 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C46H74N4O35 |
---|
Molecular Mass | 1242.4134 |
---|
SMILES | CC(=O)NC1C(O)CC(OCC2OC(OC3C(O)C(CO)OC(OC(=O)CC(N)C(=O)O)C3O)C(NC(C)=O)C(OC3OC(CO)C(O)C(OC4(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O4)C3O)C2O)(C(=O)O)OC1C(O)C(O)CO |
---|
InChI Key | VRMAKQBSKMXOJJ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | n-acyl-alpha-hexosamines |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | acetamidesalpha amino acidsaspartic acid and derivativesc-glucuronidescarbonyl compoundscarboxylic acid esterscarboxylic acidsfatty acid estersfatty acyl glycosides of mono- and disaccharideshydrocarbon derivativesketalsmonoalkylaminesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcoholssecondary carboxylic acid amidestetracarboxylic acids and derivatives |
---|
Substituents | fatty acylfatty acyl glycoside of mono- or disaccharidecarbonyl groupcarboxylic acidmonosaccharidealpha-amino acid or derivativescarboxylic acid derivativepyran carboxylic acidn-acyl-alpha-hexosamineorganic oxideacetalketalaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidec-glucuronidealcoholpyran carboxylic acid or derivativesfatty acyl glycosidetetracarboxylic acid or derivativescarboxamide groupoxacyclesecondary carboxylic acid amidefatty acid esterpyrancarboxylic acid esteraspartic acid or derivativessecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compound |
---|