| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 17:23:25 UTC |
|---|
| Update Date | 2025-03-25 01:49:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02533230 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C33H56N2O27S |
|---|
| Molecular Mass | 944.2791 |
|---|
| SMILES | CC(=O)NC1C(OC2C(O)C(OS(C)(=O)=O)OC(C(O)CO)C2O)OC(CO)C(OC2OC(COC3(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O3)C(O)C(O)C2O)C1O |
|---|
| InChI Key | FXHNCWKDXFIFGH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-acyl-alpha-hexosamines |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesc-glucuronidescarbonyl compoundscarboxylic acidshydrocarbon derivativesketalsmethanesulfonatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonic acid estersoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcoholssecondary carboxylic acid amidessulfonic acid esterssulfonyls |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl groupcarboxylic acidmonosaccharideorganosulfur compoundcarboxylic acid derivativepyran carboxylic acidn-acyl-alpha-hexosaminesulfonic acid esterorganic oxideacetalketalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidec-glucuronidealcoholpyran carboxylic acid or derivativescarboxamide grouporganosulfonic acid estermethanesulfonateoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativessulfonylorganic sulfonic acid or derivativespyransecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
|---|